C25H29F3N4O5S2 — CID 88876499
5,5-dimethyl-1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 88876499) has the molecular formula C25H29F3N4O5S2 and a molecular weight of 586.66 g/mol. Its IUPAC name is 5,5-dimethyl-1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 88876499 |
| Molecular Formula | C25H29F3N4O5S2 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | 5,5-dimethyl-1-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)NC(=O)N1C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1c1ccc([C@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H29F3N4O5S2/c1-23(2)21(33)29-22(34)32(23)15-18-14-30(39(36,37)20-7-5-4-6-19(20)38)12-13-31(18)17-10-8-16(9-11-17)24(3,35)25(26,27)28/h4-5,7-11,18,35H,6,12-15H2,1-3H3,(H,29,33,34)/t18-,24+/m1/s1 |
| InChIKey | KIZNIPLDIVPEOU-KOSHJBKYSA-N |
| XLogP | 2.82 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|