C25H32F3N3O4S2 — CID 87058198
2-[(3S)-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87058198) has the molecular formula C25H32F3N3O4S2 and a molecular weight of 559.68 g/mol. Its IUPAC name is 2-[(3S)-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[(3S)-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87058198 |
| Molecular Formula | C25H32F3N3O4S2 |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 2-[(3S)-3-[[(2S)-2-methylmorpholin-4-yl]methyl]-4-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | C[C@H]1CN(C[C@H]2CN(S(=O)(=O)C3=CC=CCC3=S)CCN2c2ccc(C(C)(O)C(F)(F)F)cc2)CCO1 |
| InChI | InChI=1S/C25H32F3N3O4S2/c1-18-15-29(13-14-35-18)16-21-17-30(37(33,34)23-6-4-3-5-22(23)36)11-12-31(21)20-9-7-19(8-10-20)24(2,32)25(26,27)28/h3-4,6-10,18,21,32H,5,11-17H2,1-2H3/t18-,21-,24?/m0/s1 |
| InChIKey | NPZTZQGNXKBDGC-BNVZOUMQSA-N |
| XLogP | 3.21 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|