C28H29F4N3O4S2 — CID 87059190
N-(4-fluorophenyl)-N-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]acetamide (PubChem CID 87059190) has the molecular formula C28H29F4N3O4S2 and a molecular weight of 611.68 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]acetamide.
| Compound Name | N-(4-fluorophenyl)-N-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 87059190 |
| Molecular Formula | C28H29F4N3O4S2 |
| Molecular Weight | 611.68 g/mol |
| Exact Mass | 611.15 |
| IUPAC Name | N-(4-fluorophenyl)-N-[[(2S)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2R)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]acetamide |
| SMILES | CC(=O)N(C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1c1ccc([C@@](C)(O)C(F)(F)F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H29F4N3O4S2/c1-19(36)35(23-13-9-21(29)10-14-23)18-24-17-33(41(38,39)26-6-4-3-5-25(26)40)15-16-34(24)22-11-7-20(8-12-22)27(2,37)28(30,31)32/h3-4,6-14,24,37H,5,15-18H2,1-2H3/t24-,27-/m1/s1 |
| InChIKey | DNUCNHWPGCUJOO-SHQCIBLASA-N |
| XLogP | 4.68 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.68 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|