C28H33F3N4O5S3 — CID 87058272
N-propan-2-yl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]pyridine-3-sulfonamide (PubChem CID 87058272) has the molecular formula C28H33F3N4O5S3 and a molecular weight of 658.79 g/mol. Its IUPAC name is N-propan-2-yl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]pyridine-3-sulfonamide.
| Compound Name | N-propan-2-yl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 87058272 |
| Molecular Formula | C28H33F3N4O5S3 |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.16 |
| IUPAC Name | N-propan-2-yl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]pyridine-3-sulfonamide |
| SMILES | CC(C)N(C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1)S(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C28H33F3N4O5S3/c1-20(2)35(42(37,38)24-7-6-14-32-17-24)19-23-18-33(43(39,40)26-9-5-4-8-25(26)41)15-16-34(23)22-12-10-21(11-13-22)27(3,36)28(29,30)31/h4-7,9-14,17,20,23,36H,8,15-16,18-19H2,1-3H3/t23-,27?/m1/s1 |
| InChIKey | GAVQFXKYPMZKLT-BRIWLPCBSA-N |
| XLogP | 3.98 |
| TPSA | 111.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|