C27H30F3N3O5S3 — CID 87058535
N-phenyl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide (PubChem CID 87058535) has the molecular formula C27H30F3N3O5S3 and a molecular weight of 629.75 g/mol. Its IUPAC name is N-phenyl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-phenyl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 87058535 |
| Molecular Formula | C27H30F3N3O5S3 |
| Molecular Weight | 629.75 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | N-phenyl-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2CN(c2ccccc2)S(C)(=O)=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H30F3N3O5S3/c1-26(34,27(28,29)30)20-12-14-21(15-13-20)32-17-16-31(41(37,38)25-11-7-6-10-24(25)39)18-23(32)19-33(40(2,35)36)22-8-4-3-5-9-22/h3-9,11-15,23,34H,10,16-19H2,1-2H3/t23-,26+/m1/s1 |
| InChIKey | HIESACKKVOAYLR-BVAGGSTKSA-N |
| XLogP | 3.96 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|