C24H30F3N3O6S3 — CID 88876578
N-(oxetan-3-yl)-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide (PubChem CID 88876578) has the molecular formula C24H30F3N3O6S3 and a molecular weight of 609.71 g/mol. Its IUPAC name is N-(oxetan-3-yl)-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-(oxetan-3-yl)-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 88876578 |
| Molecular Formula | C24H30F3N3O6S3 |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | N-(oxetan-3-yl)-N-[[(2R)-4-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-1-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-2-yl]methyl]methanesulfonamide |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC=CCC3=S)C[C@@H]2CN(C2COC2)S(C)(=O)=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H30F3N3O6S3/c1-23(31,24(25,26)27)17-7-9-18(10-8-17)29-12-11-28(39(34,35)22-6-4-3-5-21(22)37)13-19(29)14-30(38(2,32)33)20-15-36-16-20/h3-4,6-10,19-20,31H,5,11-16H2,1-2H3/t19-,23+/m1/s1 |
| InChIKey | RNEOUKQWFVICTL-XXBNENTESA-N |
| XLogP | 2.15 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|