C20H23F3N2O3S2 — CID 123776855
1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 123776855) has the molecular formula C20H23F3N2O3S2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 123776855 |
| Molecular Formula | C20H23F3N2O3S2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[(2S)-2-methyl-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccccc2S)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N2O3S2/c1-14-13-24(30(27,28)18-6-4-3-5-17(18)29)11-12-25(14)16-9-7-15(8-10-16)19(2,26)20(21,22)23/h3-10,14,26,29H,11-13H2,1-2H3/t14-,19?/m0/s1 |
| InChIKey | PAZBPQPKAQUZCD-KTQQKIMGSA-N |
| XLogP | 3.64 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|