C21H26F3N3O3S2 — CID 123679992
1,1,1-trifluoro-2-[4-[(2S)-2-(methylaminomethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 123679992) has the molecular formula C21H26F3N3O3S2 and a molecular weight of 489.59 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[(2S)-2-(methylaminomethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[(2S)-2-(methylaminomethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 123679992 |
| Molecular Formula | C21H26F3N3O3S2 |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[(2S)-2-(methylaminomethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CNC[C@H]1CN(S(=O)(=O)c2ccccc2S)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H26F3N3O3S2/c1-20(28,21(22,23)24)15-7-9-16(10-8-15)27-12-11-26(14-17(27)13-25-2)32(29,30)19-6-4-3-5-18(19)31/h3-10,17,25,28,31H,11-14H2,1-2H3/t17-,20?/m0/s1 |
| InChIKey | XDZCOQYRUHKSKM-DIMJTDRSSA-N |
| XLogP | 2.84 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|