C26H32F3N3O4S2 — CID 123992308
2-[4-[(2S)-2-[[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123992308) has the molecular formula C26H32F3N3O4S2 and a molecular weight of 571.69 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-2-[[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123992308 |
| Molecular Formula | C26H32F3N3O4S2 |
| Molecular Weight | 571.69 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[4-[(2S)-2-[[(3aR,6aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)c3ccccc3S)C[C@@H]2CN2C[C@H]3COC[C@H]3C2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H32F3N3O4S2/c1-25(33,26(27,28)29)20-6-8-21(9-7-20)32-11-10-31(38(34,35)24-5-3-2-4-23(24)37)15-22(32)14-30-12-18-16-36-17-19(18)13-30/h2-9,18-19,22,33,37H,10-17H2,1H3/t18-,19+,22-,25?/m0/s1 |
| InChIKey | VQVZYQJGCXLMED-BHBIZHBUSA-N |
| XLogP | 3.20 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|