C26H34F3N3O4S2 — CID 123549209
(2R)-2-[4-[(2R)-2-[(2,2-dimethylmorpholin-4-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123549209) has the molecular formula C26H34F3N3O4S2 and a molecular weight of 573.70 g/mol. Its IUPAC name is (2R)-2-[4-[(2R)-2-[(2,2-dimethylmorpholin-4-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2R)-2-[4-[(2R)-2-[(2,2-dimethylmorpholin-4-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123549209 |
| Molecular Formula | C26H34F3N3O4S2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | (2R)-2-[4-[(2R)-2-[(2,2-dimethylmorpholin-4-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC1(C)CN(C[C@@H]2CN(S(=O)(=O)c3ccccc3S)CCN2c2ccc([C@@](C)(O)C(F)(F)F)cc2)CCO1 |
| InChI | InChI=1S/C26H34F3N3O4S2/c1-24(2)18-30(14-15-36-24)16-21-17-31(38(34,35)23-7-5-4-6-22(23)37)12-13-32(21)20-10-8-19(9-11-20)25(3,33)26(27,28)29/h4-11,21,33,37H,12-18H2,1-3H3/t21-,25-/m1/s1 |
| InChIKey | YTRZHHKUHZUFOK-PXDATVDWSA-N |
| XLogP | 3.74 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|