C20H23F3N2O4S2 — CID 123661267
(2R)-1,1,1-trifluoro-2-[4-[(2S)-2-(hydroxymethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 123661267) has the molecular formula C20H23F3N2O4S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-[4-[(2S)-2-(hydroxymethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-2-[4-[(2S)-2-(hydroxymethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 123661267 |
| Molecular Formula | C20H23F3N2O4S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-[4-[(2S)-2-(hydroxymethyl)-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@@](O)(c1ccc(N2CCN(S(=O)(=O)c3ccccc3S)C[C@H]2CO)cc1)C(F)(F)F |
| InChI | InChI=1S/C20H23F3N2O4S2/c1-19(27,20(21,22)23)14-6-8-15(9-7-14)25-11-10-24(12-16(25)13-26)31(28,29)18-5-3-2-4-17(18)30/h2-9,16,26-27,30H,10-13H2,1H3/t16-,19+/m0/s1 |
| InChIKey | IPYXNPNPGLKFKK-QFBILLFUSA-N |
| XLogP | 2.62 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|