C29H34F3N3O5S3 — CID 123209066
N-(1-phenylethyl)-N-[[(2R)-4-(2-sulfanylphenyl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]methanesulfonamide (PubChem CID 123209066) has the molecular formula C29H34F3N3O5S3 and a molecular weight of 657.80 g/mol. Its IUPAC name is N-(1-phenylethyl)-N-[[(2R)-4-(2-sulfanylphenyl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-(1-phenylethyl)-N-[[(2R)-4-(2-sulfanylphenyl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 123209066 |
| Molecular Formula | C29H34F3N3O5S3 |
| Molecular Weight | 657.80 g/mol |
| Exact Mass | 657.16 |
| IUPAC Name | N-(1-phenylethyl)-N-[[(2R)-4-(2-sulfanylphenyl)sulfonyl-1-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]piperazin-2-yl]methyl]methanesulfonamide |
| SMILES | CC(c1ccccc1)N(C[C@H]1CN(S(=O)(=O)c2ccccc2S)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H34F3N3O5S3/c1-21(22-9-5-4-6-10-22)35(42(3,37)38)20-25-19-33(43(39,40)27-12-8-7-11-26(27)41)17-18-34(25)24-15-13-23(14-16-24)28(2,36)29(30,31)32/h4-16,21,25,36,41H,17-20H2,1-3H3/t21?,25-,28?/m1/s1 |
| InChIKey | ZCNVHSROKJZEMZ-ZUYJMMGOSA-N |
| XLogP | 4.65 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.80 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|