C24H30F3N3O3S2 — CID 123727778
2-[4-[(2S)-2-[(cyclopropylmethylamino)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123727778) has the molecular formula C24H30F3N3O3S2 and a molecular weight of 529.65 g/mol. Its IUPAC name is 2-[4-[(2S)-2-[(cyclopropylmethylamino)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-2-[(cyclopropylmethylamino)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123727778 |
| Molecular Formula | C24H30F3N3O3S2 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 2-[4-[(2S)-2-[(cyclopropylmethylamino)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(N2CCN(S(=O)(=O)c3ccccc3S)C[C@@H]2CNCC2CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H30F3N3O3S2/c1-23(31,24(25,26)27)18-8-10-19(11-9-18)30-13-12-29(16-20(30)15-28-14-17-6-7-17)35(32,33)22-5-3-2-4-21(22)34/h2-5,8-11,17,20,28,31,34H,6-7,12-16H2,1H3/t20-,23?/m0/s1 |
| InChIKey | WJBPCDVREKKKFF-AJZOCDQUSA-N |
| XLogP | 3.62 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|