C25H30F5N3O3S2 — CID 123459864
(2S)-2-[4-[(2S)-2-[(4,4-difluoropiperidin-1-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123459864) has the molecular formula C25H30F5N3O3S2 and a molecular weight of 579.66 g/mol. Its IUPAC name is (2S)-2-[4-[(2S)-2-[(4,4-difluoropiperidin-1-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-2-[4-[(2S)-2-[(4,4-difluoropiperidin-1-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123459864 |
| Molecular Formula | C25H30F5N3O3S2 |
| Molecular Weight | 579.66 g/mol |
| Exact Mass | 579.16 |
| IUPAC Name | (2S)-2-[4-[(2S)-2-[(4,4-difluoropiperidin-1-yl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)c3ccccc3S)C[C@@H]2CN2CCC(F)(F)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C25H30F5N3O3S2/c1-23(34,25(28,29)30)18-6-8-19(9-7-18)33-15-14-32(38(35,36)22-5-3-2-4-21(22)37)17-20(33)16-31-12-10-24(26,27)11-13-31/h2-9,20,34,37H,10-17H2,1H3/t20-,23-/m0/s1 |
| InChIKey | KPWPZLJNYIDEOT-REWPJTCUSA-N |
| XLogP | 4.36 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|