C26H26F4N2O3S2 — CID 123690446
(2S)-1,1,1-trifluoro-2-[4-[(2R)-2-[(3-fluorophenyl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 123690446) has the molecular formula C26H26F4N2O3S2 and a molecular weight of 554.63 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-[4-[(2R)-2-[(3-fluorophenyl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-2-[4-[(2R)-2-[(3-fluorophenyl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 123690446 |
| Molecular Formula | C26H26F4N2O3S2 |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-[4-[(2R)-2-[(3-fluorophenyl)methyl]-4-(2-sulfanylphenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)c3ccccc3S)C[C@H]2Cc2cccc(F)c2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H26F4N2O3S2/c1-25(33,26(28,29)30)19-9-11-21(12-10-19)32-14-13-31(37(34,35)24-8-3-2-7-23(24)36)17-22(32)16-18-5-4-6-20(27)15-18/h2-12,15,22,33,36H,13-14,16-17H2,1H3/t22-,25+/m1/s1 |
| InChIKey | YJUSHSHDLPESNL-RDGATRHJSA-N |
| XLogP | 5.01 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|