C20H24F3N3O3S2 — CID 123354875
2-[4-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123354875) has the molecular formula C20H24F3N3O3S2 and a molecular weight of 475.56 g/mol. Its IUPAC name is 2-[4-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123354875 |
| Molecular Formula | C20H24F3N3O3S2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[4-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-methylpiperazin-1-yl]phenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cc(N)ccc2S)CCN1c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H24F3N3O3S2/c1-13-12-25(31(28,29)18-11-15(24)5-8-17(18)30)9-10-26(13)16-6-3-14(4-7-16)19(2,27)20(21,22)23/h3-8,11,13,27,30H,9-10,12,24H2,1-2H3/t13-,19?/m0/s1 |
| InChIKey | DPNLNCYCSQIAGT-YTJLLHSVSA-N |
| XLogP | 3.23 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|