C23H30F3N5O4S2 — CID 123652530
2-[2-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 123652530) has the molecular formula C23H30F3N5O4S2 and a molecular weight of 561.65 g/mol. Its IUPAC name is 2-[2-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[2-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 123652530 |
| Molecular Formula | C23H30F3N5O4S2 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 2-[2-[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1cnc(N2CCN(S(=O)(=O)c3cc(N)ccc3S)C[C@@H]2CC2CCOCC2)nc1)C(F)(F)F |
| InChI | InChI=1S/C23H30F3N5O4S2/c1-22(32,23(24,25)26)16-12-28-21(29-13-16)31-7-6-30(14-18(31)10-15-4-8-35-9-5-15)37(33,34)20-11-17(27)2-3-19(20)36/h2-3,11-13,15,18,32,36H,4-10,14,27H2,1H3/t18-,22?/m0/s1 |
| InChIKey | QEYRIWURVPGCEP-HXBUSHRASA-N |
| XLogP | 2.81 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|