C24H29F6N7O4S2 — CID 123243163
4-[[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one (PubChem CID 123243163) has the molecular formula C24H29F6N7O4S2 and a molecular weight of 657.66 g/mol. Its IUPAC name is 4-[[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 123243163 |
| Molecular Formula | C24H29F6N7O4S2 |
| Molecular Weight | 657.66 g/mol |
| Exact Mass | 657.16 |
| IUPAC Name | 4-[[(2S)-4-(5-amino-2-sulfanylphenyl)sulfonyl-1-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C[C@H]1CN(S(=O)(=O)c2cc(N)ccc2S)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C24H29F6N7O4S2/c1-21(2)19(38)32-5-6-35(21)12-16-13-36(43(40,41)18-9-15(31)3-4-17(18)42)7-8-37(16)20-33-10-14(11-34-20)22(39,23(25,26)27)24(28,29)30/h3-4,9-11,16,39,42H,5-8,12-13,31H2,1-2H3,(H,32,38)/t16-/m0/s1 |
| InChIKey | NWJBCOQNMRGMTL-INIZCTEOSA-N |
| XLogP | 1.75 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|