C10H16N2O2S2 — CID 115312618
2-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine (PubChem CID 115312618) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine.
| Compound Name | 2-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 115312618 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 2-methyl-1-thiophen-2-ylsulfonylpiperidin-4-amine |
| SMILES | CC1CC(N)CCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C10H16N2O2S2/c1-8-7-9(11)4-5-12(8)16(13,14)10-3-2-6-15-10/h2-3,6,8-9H,4-5,7,11H2,1H3 |
| InChIKey | JOIBPVFXDMJBFT-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |