C10H15NO3S2 — CID 2942574
2,6-dimethyl-4-thiophen-2-ylsulfonylmorpholine (PubChem CID 2942574) has the molecular formula C10H15NO3S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2,6-dimethyl-4-thiophen-2-ylsulfonylmorpholine.
| Compound Name | 2,6-dimethyl-4-thiophen-2-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 2942574 |
| Molecular Formula | C10H15NO3S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2,6-dimethyl-4-thiophen-2-ylsulfonylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2cccs2)CC(C)O1 |
| InChI | InChI=1S/C10H15NO3S2/c1-8-6-11(7-9(2)14-8)16(12,13)10-4-3-5-15-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | FNFUHIIRUAOWNA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |