C10H13NO4S2 — CID 116681724
2-(1-thiophen-2-ylsulfonylazetidin-3-yl)propanoic acid (PubChem CID 116681724) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(1-thiophen-2-ylsulfonylazetidin-3-yl)propanoic acid.
| Compound Name | 2-(1-thiophen-2-ylsulfonylazetidin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 116681724 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 2-(1-thiophen-2-ylsulfonylazetidin-3-yl)propanoic acid |
| SMILES | CC(C(=O)O)C1CN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C10H13NO4S2/c1-7(10(12)13)8-5-11(6-8)17(14,15)9-3-2-4-16-9/h2-4,7-8H,5-6H2,1H3,(H,12,13) |
| InChIKey | KYCGKBZZBUARED-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |