C10H10N4O4S2 — CID 79311323
1-(1-thiophen-2-ylsulfonylazetidin-3-yl)triazole-4-carboxylic acid (PubChem CID 79311323) has the molecular formula C10H10N4O4S2 and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(1-thiophen-2-ylsulfonylazetidin-3-yl)triazole-4-carboxylic acid.
| Compound Name | 1-(1-thiophen-2-ylsulfonylazetidin-3-yl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79311323 |
| Molecular Formula | C10H10N4O4S2 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 1-(1-thiophen-2-ylsulfonylazetidin-3-yl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CN(S(=O)(=O)c3cccs3)C2)nn1 |
| InChI | InChI=1S/C10H10N4O4S2/c15-10(16)8-6-14(12-11-8)7-4-13(5-7)20(17,18)9-2-1-3-19-9/h1-3,6-7H,4-5H2,(H,15,16) |
| InChIKey | MPKDOAMDSNAICE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |