C12H13N5O3S — CID 115287483
1-[1-(2-amino-2-thiophen-2-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 115287483) has the molecular formula C12H13N5O3S and a molecular weight of 307.34 g/mol. Its IUPAC name is 1-[1-(2-amino-2-thiophen-2-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-amino-2-thiophen-2-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115287483 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-[1-(2-amino-2-thiophen-2-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | NC(C(=O)N1CC(n2cc(C(=O)O)nn2)C1)c1cccs1 |
| InChI | InChI=1S/C12H13N5O3S/c13-10(9-2-1-3-21-9)11(18)16-4-7(5-16)17-6-8(12(19)20)14-15-17/h1-3,6-7,10H,4-5,13H2,(H,19,20) |
| InChIKey | VAIKOGKHMUVTGH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |