C11H15N5O5 — CID 79311905
1-[1-(2-amino-4-carboxybutanoyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79311905) has the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 1-[1-(2-amino-4-carboxybutanoyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-amino-4-carboxybutanoyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79311905 |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[1-(2-amino-4-carboxybutanoyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | NC(CCC(=O)O)C(=O)N1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C11H15N5O5/c12-7(1-2-9(17)18)10(19)15-3-6(4-15)16-5-8(11(20)21)13-14-16/h5-7H,1-4,12H2,(H,17,18)(H,20,21) |
| InChIKey | ZPZCLAMIPJWBNP-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 151.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |