C12H18N6O3 — CID 79311493
1-[1-(4-aminopiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79311493) has the molecular formula C12H18N6O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-[1-(4-aminopiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(4-aminopiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79311493 |
| Molecular Formula | C12H18N6O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[1-(4-aminopiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | NC1CCN(C(=O)N2CC(n3cc(C(=O)O)nn3)C2)CC1 |
| InChI | InChI=1S/C12H18N6O3/c13-8-1-3-16(4-2-8)12(21)17-5-9(6-17)18-7-10(11(19)20)14-15-18/h7-9H,1-6,13H2,(H,19,20) |
| InChIKey | NLOMYMCSCSLQDQ-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |