C13H19N5O3 — CID 79310630
1-[1-(2-methylpiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79310630) has the molecular formula C13H19N5O3 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1-[1-(2-methylpiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-methylpiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79310630 |
| Molecular Formula | C13H19N5O3 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-[1-(2-methylpiperidine-1-carbonyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | CC1CCCCN1C(=O)N1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C13H19N5O3/c1-9-4-2-3-5-17(9)13(21)16-6-10(7-16)18-8-11(12(19)20)14-15-18/h8-10H,2-7H2,1H3,(H,19,20) |
| InChIKey | UIBBYMARKVHAJC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |