C14H22N4O2 — CID 79308948
1-[1-(2-ethylcyclohexyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79308948) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-[1-(2-ethylcyclohexyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-ethylcyclohexyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79308948 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 1-[1-(2-ethylcyclohexyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | CCC1CCCCC1N1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C14H22N4O2/c1-2-10-5-3-4-6-13(10)17-7-11(8-17)18-9-12(14(19)20)15-16-18/h9-11,13H,2-8H2,1H3,(H,19,20) |
| InChIKey | IBMQXKIFZFUYFK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |