C10H14N4O3 — CID 79308885
1-[1-(2-methylpropanoyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79308885) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-[1-(2-methylpropanoyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-methylpropanoyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79308885 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-[1-(2-methylpropanoyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | CC(C)C(=O)N1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C10H14N4O3/c1-6(2)9(15)13-3-7(4-13)14-5-8(10(16)17)11-12-14/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | QJMGPXYSJNOSAC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |