C11H16N4O2 — CID 129493827
1-[(3R)-1-cyclobutylpyrrolidin-3-yl]triazole-4-carboxylic acid (PubChem CID 129493827) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1-[(3R)-1-cyclobutylpyrrolidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[(3R)-1-cyclobutylpyrrolidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 129493827 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-[(3R)-1-cyclobutylpyrrolidin-3-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn([C@@H]2CCN(C3CCC3)C2)nn1 |
| InChI | InChI=1S/C11H16N4O2/c16-11(17)10-7-15(13-12-10)9-4-5-14(6-9)8-2-1-3-8/h7-9H,1-6H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | CIRQUFYPNBUIQJ-SECBINFHSA-N |
| XLogP | 0.78 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |