C11H15N5O3 — CID 104901262
1-[1-[(2R)-pyrrolidine-2-carbonyl]azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 104901262) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1-[1-[(2R)-pyrrolidine-2-carbonyl]azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-[(2R)-pyrrolidine-2-carbonyl]azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 104901262 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-[1-[(2R)-pyrrolidine-2-carbonyl]azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CN(C(=O)[C@H]3CCCN3)C2)nn1 |
| InChI | InChI=1S/C11H15N5O3/c17-10(8-2-1-3-12-8)15-4-7(5-15)16-6-9(11(18)19)13-14-16/h6-8,12H,1-5H2,(H,18,19)/t8-/m1/s1 |
| InChIKey | IQTJBSIXLKSSKA-MRVPVSSYSA-N |
| XLogP | -0.89 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |