C12H17N5O3S — CID 79308861
1-[1-(2-thiomorpholin-3-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79308861) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-[1-(2-thiomorpholin-3-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-thiomorpholin-3-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79308861 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[1-(2-thiomorpholin-3-ylacetyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CN(C(=O)CC3CSCCN3)C2)nn1 |
| InChI | InChI=1S/C12H17N5O3S/c18-11(3-8-7-21-2-1-13-8)16-4-9(5-16)17-6-10(12(19)20)14-15-17/h6,8-9,13H,1-5,7H2,(H,19,20) |
| InChIKey | BCINHFKKBMVMTP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |