C12H14N4O5S — CID 146092901
1-[1-(furan-3-ylsulfonyl)piperidin-3-yl]triazole-4-carboxylic acid (PubChem CID 146092901) has the molecular formula C12H14N4O5S and a molecular weight of 326.33 g/mol. Its IUPAC name is 1-[1-(furan-3-ylsulfonyl)piperidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(furan-3-ylsulfonyl)piperidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146092901 |
| Molecular Formula | C12H14N4O5S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 1-[1-(furan-3-ylsulfonyl)piperidin-3-yl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CCCN(S(=O)(=O)c3ccoc3)C2)nn1 |
| InChI | InChI=1S/C12H14N4O5S/c17-12(18)11-7-16(14-13-11)9-2-1-4-15(6-9)22(19,20)10-3-5-21-8-10/h3,5,7-9H,1-2,4,6H2,(H,17,18) |
| InChIKey | AVTNIHLGFRWLLR-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |