C17H22FN5O4S — CID 42348901
1-[(3R)-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 42348901) has the molecular formula C17H22FN5O4S and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-[(3R)-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide.
| Compound Name | 1-[(3R)-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 42348901 |
| Molecular Formula | C17H22FN5O4S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 1-[(3R)-1-(2-fluorophenyl)sulfonylpiperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn([C@@H]2CCCN(S(=O)(=O)c3ccccc3F)C2)nn1 |
| InChI | InChI=1S/C17H22FN5O4S/c1-27-10-8-19-17(24)15-12-23(21-20-15)13-5-4-9-22(11-13)28(25,26)16-7-3-2-6-14(16)18/h2-3,6-7,12-13H,4-5,8-11H2,1H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | BELYYHPTHKIXRY-CYBMUJFWSA-N |
| XLogP | 0.82 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|