C20H33N5O3 — CID 45239626
1-[1-(3-cyclohexylpropanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 45239626) has the molecular formula C20H33N5O3 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-[1-(3-cyclohexylpropanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide.
| Compound Name | 1-[1-(3-cyclohexylpropanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 45239626 |
| Molecular Formula | C20H33N5O3 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 1-[1-(3-cyclohexylpropanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn(C2CCCN(C(=O)CCC3CCCCC3)C2)nn1 |
| InChI | InChI=1S/C20H33N5O3/c1-28-13-11-21-20(27)18-15-25(23-22-18)17-8-5-12-24(14-17)19(26)10-9-16-6-3-2-4-7-16/h15-17H,2-14H2,1H3,(H,21,27) |
| InChIKey | ROLOWTJKFAYSJA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|