C19H24ClN5O3 — CID 45250926
1-[1-[2-(4-chlorophenyl)acetyl]piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 45250926) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is 1-[1-[2-(4-chlorophenyl)acetyl]piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide.
| Compound Name | 1-[1-[2-(4-chlorophenyl)acetyl]piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 45250926 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[1-[2-(4-chlorophenyl)acetyl]piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn(C2CCCN(C(=O)Cc3ccc(Cl)cc3)C2)nn1 |
| InChI | InChI=1S/C19H24ClN5O3/c1-28-10-8-21-19(27)17-13-25(23-22-17)16-3-2-9-24(12-16)18(26)11-14-4-6-15(20)7-5-14/h4-7,13,16H,2-3,8-12H2,1H3,(H,21,27) |
| InChIKey | XNOYWJWQWUSIFA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|