C17H29N5O3 — CID 25290420
1-[(3S)-1-(3,3-dimethylbutanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide (PubChem CID 25290420) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[(3S)-1-(3,3-dimethylbutanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide.
| Compound Name | 1-[(3S)-1-(3,3-dimethylbutanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 25290420 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 1-[(3S)-1-(3,3-dimethylbutanoyl)piperidin-3-yl]-N-(2-methoxyethyl)triazole-4-carboxamide |
| SMILES | COCCNC(=O)c1cn([C@H]2CCCN(C(=O)CC(C)(C)C)C2)nn1 |
| InChI | InChI=1S/C17H29N5O3/c1-17(2,3)10-15(23)21-8-5-6-13(11-21)22-12-14(19-20-22)16(24)18-7-9-25-4/h12-13H,5-11H2,1-4H3,(H,18,24)/t13-/m0/s1 |
| InChIKey | GMTULLXJZYBLAS-ZDUSSCGKSA-N |
| XLogP | 1.25 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|