C10H15N5O4 — CID 79312191
1-[1-(2-methoxyethylcarbamoyl)azetidin-3-yl]triazole-4-carboxylic acid (PubChem CID 79312191) has the molecular formula C10H15N5O4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 1-[1-(2-methoxyethylcarbamoyl)azetidin-3-yl]triazole-4-carboxylic acid.
| Compound Name | 1-[1-(2-methoxyethylcarbamoyl)azetidin-3-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 79312191 |
| Molecular Formula | C10H15N5O4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 1-[1-(2-methoxyethylcarbamoyl)azetidin-3-yl]triazole-4-carboxylic acid |
| SMILES | COCCNC(=O)N1CC(n2cc(C(=O)O)nn2)C1 |
| InChI | InChI=1S/C10H15N5O4/c1-19-3-2-11-10(18)14-4-7(5-14)15-6-8(9(16)17)12-13-15/h6-7H,2-5H2,1H3,(H,11,18)(H,16,17) |
| InChIKey | PMFRXYUKFBWHEG-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|