C18H24ClN5O2 — CID 45234972
1-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide (PubChem CID 45234972) has the molecular formula C18H24ClN5O2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 45234972 |
| Molecular Formula | C18H24ClN5O2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide |
| SMILES | O=C(NCCCO)c1cn(C2CCCN(Cc3ccc(Cl)cc3)C2)nn1 |
| InChI | InChI=1S/C18H24ClN5O2/c19-15-6-4-14(5-7-15)11-23-9-1-3-16(12-23)24-13-17(21-22-24)18(26)20-8-2-10-25/h4-7,13,16,25H,1-3,8-12H2,(H,20,26) |
| InChIKey | KCUYICIBHUEYFP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|