C25H31N5O2 — CID 26281259
1-[(3R)-1-(2,2-diphenylethyl)piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide (PubChem CID 26281259) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-[(3R)-1-(2,2-diphenylethyl)piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide.
| Compound Name | 1-[(3R)-1-(2,2-diphenylethyl)piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 26281259 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-[(3R)-1-(2,2-diphenylethyl)piperidin-3-yl]-N-(3-hydroxypropyl)triazole-4-carboxamide |
| SMILES | O=C(NCCCO)c1cn([C@@H]2CCCN(CC(c3ccccc3)c3ccccc3)C2)nn1 |
| InChI | InChI=1S/C25H31N5O2/c31-16-8-14-26-25(32)24-19-30(28-27-24)22-13-7-15-29(17-22)18-23(20-9-3-1-4-10-20)21-11-5-2-6-12-21/h1-6,9-12,19,22-23,31H,7-8,13-18H2,(H,26,32)/t22-/m1/s1 |
| InChIKey | GBNYCTDLONEONA-JOCHJYFZSA-N |
| XLogP | 2.86 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|