C24H36N6O2 — CID 126464666
N-(3-hydroxypropyl)-1-[1-[1-(2-phenylethyl)piperidin-4-yl]piperidin-4-yl]triazole-4-carboxamide (PubChem CID 126464666) has the molecular formula C24H36N6O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-1-[1-[1-(2-phenylethyl)piperidin-4-yl]piperidin-4-yl]triazole-4-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-1-[1-[1-(2-phenylethyl)piperidin-4-yl]piperidin-4-yl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 126464666 |
| Molecular Formula | C24H36N6O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | N-(3-hydroxypropyl)-1-[1-[1-(2-phenylethyl)piperidin-4-yl]piperidin-4-yl]triazole-4-carboxamide |
| SMILES | O=C(NCCCO)c1cn(C2CCN(C3CCN(CCc4ccccc4)CC3)CC2)nn1 |
| InChI | InChI=1S/C24H36N6O2/c31-18-4-12-25-24(32)23-19-30(27-26-23)22-10-16-29(17-11-22)21-8-14-28(15-9-21)13-7-20-5-2-1-3-6-20/h1-3,5-6,19,21-22,31H,4,7-18H2,(H,25,32) |
| InChIKey | CAUUAKZDRLEMSW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|