C24H39N3O2 — CID 28767990
N-(3-methoxypropyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 28767990) has the molecular formula C24H39N3O2 and a molecular weight of 401.60 g/mol. Its IUPAC name is N-(3-methoxypropyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-(3-methoxypropyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28767990 |
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.30 |
| IUPAC Name | N-(3-methoxypropyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | COCCCNC(=O)C1CCN(C2CCN(CCCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C24H39N3O2/c1-29-20-6-14-25-24(28)22-10-18-27(19-11-22)23-12-16-26(17-13-23)15-5-9-21-7-3-2-4-8-21/h2-4,7-8,22-23H,5-6,9-20H2,1H3,(H,25,28) |
| InChIKey | CJVZLKKIWBTLHP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|