C25H39N3O — CID 45220804
N-(1-cyclopropylethyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 45220804) has the molecular formula C25H39N3O and a molecular weight of 397.61 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-(1-cyclopropylethyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45220804 |
| Molecular Formula | C25H39N3O |
| Molecular Weight | 397.61 g/mol |
| Exact Mass | 397.31 |
| IUPAC Name | N-(1-cyclopropylethyl)-1-[1-(3-phenylpropyl)piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(C2CCN(CCCc3ccccc3)CC2)CC1)C1CC1 |
| InChI | InChI=1S/C25H39N3O/c1-20(22-9-10-22)26-25(29)23-11-18-28(19-12-23)24-13-16-27(17-14-24)15-5-8-21-6-3-2-4-7-21/h2-4,6-7,20,22-24H,5,8-19H2,1H3,(H,26,29) |
| InChIKey | UHYZRWDLDAJZMO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.61 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |