C12H12N2O4S2 — CID 121188121
3-(1-thiophen-2-ylsulfonylazetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 121188121) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(1-thiophen-2-ylsulfonylazetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(1-thiophen-2-ylsulfonylazetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 121188121 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 3-(1-thiophen-2-ylsulfonylazetidin-3-yl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2CC2C(=O)N1C1CN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C12H12N2O4S2/c15-11-8-4-9(8)12(16)14(11)7-5-13(6-7)20(17,18)10-2-1-3-19-10/h1-3,7-9H,4-6H2 |
| InChIKey | XXRGUSQAVFISTE-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|