C14H17ClN2O2S2 — CID 120766691
(3S,4R)-4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 120766691) has the molecular formula C14H17ClN2O2S2 and a molecular weight of 344.89 g/mol. Its IUPAC name is (3S,4R)-4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S,4R)-4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120766691 |
| Molecular Formula | C14H17ClN2O2S2 |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | (3S,4R)-4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CN(S(=O)(=O)c2cccs2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H16N2O2S2.ClH/c15-13-10-16(20(17,18)14-7-4-8-19-14)9-12(13)11-5-2-1-3-6-11;/h1-8,12-13H,9-10,15H2;1H/t12-,13+;/m0./s1 |
| InChIKey | KHFDNANFMOLIAW-JHEYCYPBSA-N |
| XLogP | 2.29 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |