C26H30N2O2S2 — CID 54340655
4-phenyl-1-[(4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]piperidine (PubChem CID 54340655) has the molecular formula C26H30N2O2S2 and a molecular weight of 466.67 g/mol. Its IUPAC name is 4-phenyl-1-[(4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]piperidine.
| Compound Name | 4-phenyl-1-[(4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]piperidine |
|---|---|
| PubChem CID | 54340655 |
| Molecular Formula | C26H30N2O2S2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-phenyl-1-[(4-phenyl-1-thiophen-2-ylsulfonylpyrrolidin-3-yl)methyl]piperidine |
| SMILES | O=S(=O)(c1cccs1)N1CC(CN2CCC(c3ccccc3)CC2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C26H30N2O2S2/c29-32(30,26-12-7-17-31-26)28-19-24(25(20-28)23-10-5-2-6-11-23)18-27-15-13-22(14-16-27)21-8-3-1-4-9-21/h1-12,17,22,24-25H,13-16,18-20H2 |
| InChIKey | TYSALHKXSHZEMC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |