C8H9NO4S2 — CID 25187118
1-thiophen-2-ylsulfonylazetidine-3-carboxylic acid (PubChem CID 25187118) has the molecular formula C8H9NO4S2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-thiophen-2-ylsulfonylazetidine-3-carboxylic acid.
| Compound Name | 1-thiophen-2-ylsulfonylazetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 25187118 |
| Molecular Formula | C8H9NO4S2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 1-thiophen-2-ylsulfonylazetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C8H9NO4S2/c10-8(11)6-4-9(5-6)15(12,13)7-2-1-3-14-7/h1-3,6H,4-5H2,(H,10,11) |
| InChIKey | IAXZJIFZSDGEDZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |