C16H22N2O3S3 — CID 51331024
2,6-dimethyl-N,N-bis(thiophen-2-ylmethyl)morpholine-4-sulfonamide (PubChem CID 51331024) has the molecular formula C16H22N2O3S3 and a molecular weight of 386.56 g/mol. Its IUPAC name is 2,6-dimethyl-N,N-bis(thiophen-2-ylmethyl)morpholine-4-sulfonamide.
| Compound Name | 2,6-dimethyl-N,N-bis(thiophen-2-ylmethyl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 51331024 |
| Molecular Formula | C16H22N2O3S3 |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2,6-dimethyl-N,N-bis(thiophen-2-ylmethyl)morpholine-4-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)N(Cc2cccs2)Cc2cccs2)CC(C)O1 |
| InChI | InChI=1S/C16H22N2O3S3/c1-13-9-17(10-14(2)21-13)24(19,20)18(11-15-5-3-7-22-15)12-16-6-4-8-23-16/h3-8,13-14H,9-12H2,1-2H3 |
| InChIKey | OACVHXRNDQYLPM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |