C14H22N2O5S2 — CID 146121436
1-[2-methoxyethyl(thiophen-2-ylmethyl)sulfamoyl]piperidine-3-carboxylic acid (PubChem CID 146121436) has the molecular formula C14H22N2O5S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[2-methoxyethyl(thiophen-2-ylmethyl)sulfamoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-methoxyethyl(thiophen-2-ylmethyl)sulfamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 146121436 |
| Molecular Formula | C14H22N2O5S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 1-[2-methoxyethyl(thiophen-2-ylmethyl)sulfamoyl]piperidine-3-carboxylic acid |
| SMILES | COCCN(Cc1cccs1)S(=O)(=O)N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C14H22N2O5S2/c1-21-8-7-16(11-13-5-3-9-22-13)23(19,20)15-6-2-4-12(10-15)14(17)18/h3,5,9,12H,2,4,6-8,10-11H2,1H3,(H,17,18) |
| InChIKey | YMTYVHZBZNVXPV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |