C15H24N2O3S2 — CID 134006152
N-butan-2-yl-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 134006152) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is N-butan-2-yl-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-butan-2-yl-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 134006152 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-butan-2-yl-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CCC(C)N(C)C(=O)C1CCCN(S(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C15H24N2O3S2/c1-4-12(2)16(3)15(18)13-7-5-9-17(11-13)22(19,20)14-8-6-10-21-14/h6,8,10,12-13H,4-5,7,9,11H2,1-3H3 |
| InChIKey | DMYLNDHLNXWZIX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |