C20H26N2O4S2 — CID 24502988
N-[(4-ethoxyphenyl)methyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide (PubChem CID 24502988) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 24502988 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-N-methyl-1-thiophen-2-ylsulfonylpiperidine-3-carboxamide |
| SMILES | CCOc1ccc(CN(C)C(=O)C2CCCN(S(=O)(=O)c3cccs3)C2)cc1 |
| InChI | InChI=1S/C20H26N2O4S2/c1-3-26-18-10-8-16(9-11-18)14-21(2)20(23)17-6-4-12-22(15-17)28(24,25)19-7-5-13-27-19/h5,7-11,13,17H,3-4,6,12,14-15H2,1-2H3 |
| InChIKey | DHXSUEWLXJCJOS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |